Interpreting the H-1
hydrogen-1 (proton) NMR spectrum of 3,3-dimethylpentane
Doc
Brown's Chemistry Advanced Level Pre-University Chemistry Revision Study
Notes for UK IB KS5 A/AS GCE advanced A level organic chemistry students US
K12 grade 11 grade 12 organic chemistry courses involving molecular
spectroscopy analysing H-1 NMR spectra of 3,3-dimethylpentane
email doc
brown
Re-edit
This is a BIG
website, you need to take time to explore it
H-1 proton NMR spectroscopy -
spectra index
See also
comparing the
1H NMR and 13C NMR spectra of the nine alkane structural isomers of C7H16
1H NMR 3,3-dimethylpentane spectra note: Students and teachers please note my explanation of the
proton NMR spectrum of 3,3-dimethylpentane is designed for advanced, but
pre-university, chemistry courses. The chemical shift
δ spin-spin coupling effects for
3,3-dimethylpentane are
confined to adjacent non-equivalent protons analysed using the n+1
splitting
rule. It is assumed that the integrated intensities of the
δ chemical
shifts give the ratio of the protons in the different non-equivalent chemical
environments in the 3,3-dimethylpentane molecule.
TMS is the acronym for tetramethylsilane, formula Si(CH3)4,
whose protons are arbitrarily given a chemical shift of 0.0 ppm.
This is the 'standard' in 1H NMR spectroscopy and all
other proton resonances, called chemical shifts, are measured
with respect to the TMS, and depend on the
individual (electronic) chemical environment of the hydrogen atoms
in an organic molecule - 3,3-dimethylpentane here.
The chemical shifts quoted in ppm on the diagram of
the H-1 NMR spectrum of 3,3-dimethylpentane represent the peaks of the intensity of
the chemical shifts of (which are often groups of split lines at
high resolution) AND the relative integrated areas under the peaks
gives you the ratio of protons in the different chemical
environments of the 3,3-dimethylpentane molecule.
3,3-dimethylpentane C7H16
Interpreting the
H-1 NMR spectrum of
3,3-dimethylpentane
For relatively simple molecules, the low
resolution H-1 NMR spectrum of 3,3-dimethylpentane is NOT a good starting point
(low resolution diagram above).
Two of the 1H resonances of
3,3-dimethylpentane, for the two sets of methyl protons, are
very close together, and can only be resolved with a very
high resolution spectrometer.
So, theoretically, the 16 hydrogen atoms (protons) of
3,3-dimethylpentane can only occupy 3
different chemical environments.
CH3CH2C(CH3)2CH2CH3
Note the proton ratio
6:6:4 of the 3 colours of the protons
in the 3 chemically different environments
Chemical shifts (a) to (c) on the H-1 NMR
spectrum diagram for 3,3-dimethylpentane.
The high resolution 1H NMR
spectrum of 3,3-dimethylpentane
All low and high resolution spectra of
3,3-dimethylpentane
show 3 groups of proton resonances and in the 3 ratio expected from the
formula of 3,3-dimethylpentane (you would observe a proton ratio
of 3:3:2 for the three chemically different environments.
The ppm quoted on the diagram represent the peak
of resonance intensity for a particular proton group in the
molecule of 3,3-dimethylpentane - since the peak' is at the apex of a band of
H-1 NMR resonances due to spin - spin coupling field splitting effects - see high resolution
notes on 3,3-dimethylpentane below.
So, using the chemical shifts and applying the
n+1 rule to
3,3-dimethylpentane
and make some predictions using some colour coding! (In problem
solving you work the other way round!)
(a) 1H
Chemical shift 0.79 ppm, CH3 protons: CH3CH2C(CH3)2CH2CH3
All six
protons are equivalent to each other, in the same
chemical environment, giving the same 1-H NMR chemical
shift.
Theoretically, this 1H resonance is
split into a triplet by the neighbouring CH2
protons (n+1 = 3)
Evidence for the presence of a CH2 group
in the molecule of 3,3-dimethylpentane.
(b) 1H
Chemical shift 1.20 ppm: CH3CH2C(CH3)2CH2CH3
All four
protons are equivalent to each other, in the same
chemical environment, giving the same 1-H NMR chemical
shift.
Theoretically, this 1H resonance is
split into a quartet by the neighbouring CH3
protons (n+1 = 4), but it looks more complicated than
this on the spectrum diagram?
Evidence for the presence of a CH3 group
in the molecule of 3,3-dimethylpentane
(c) 1H
Chemical shift 0.80 ppm,
CH3 protons:CH3CH2C(CH3)2CH2CH3
All six
protons are equivalent to each other, in the same
chemical environment, giving the same 1-H NMR chemical
shift.
This resonance would not readily show
splitting because there are no protons on the
neighbouring carbon atom - a singlet is theoretically
observed.
Resonance (a) and (c) are almost
identical and on the spectrum around ~0.80 ppm is an
overlap of a singlet and a triplet.
Number of directly adjacent protons 1H
causing splitting |
Splitting pattern produced from the
n+1 rule on spin-spin coupling and the theoretical ratio of line intensities |
0
means no splitting |
|
|
|
|
|
|
1 |
|
|
|
|
|
|
1
creates a doublet |
|
|
|
|
|
1 |
|
1 |
|
|
|
|
|
2
creates a triplet |
|
|
|
|
1 |
|
2 |
|
1 |
|
|
|
|
3
creates a quartet |
|
|
|
1 |
|
3 |
|
3 |
|
1 |
|
|
|
4
creates a quintet |
|
|
1 |
|
4 |
|
6 |
|
4 |
|
1 |
|
|
5
creates a sextet |
|
1 |
|
5 |
|
10 |
|
10 |
|
5 |
|
1 |
|
6
creates a septet |
1 |
|
6 |
|
15 |
|
20 |
|
15 |
|
6 |
|
1 |
Comparing the
1H NMR and 13C NMR spectra of the nine alkane structural isomers of C7H16
You can distinguish all 9 isomers from a data combination of their number of
1H NMR
chemical shifts,
and their resulting integrated 1H proton ratios, plus, their number of
13C
chemical shifts. |
Name of the alkane structural isomer of molecular
formula C7H16 |
Abbreviated structural formulae
of the nine isomers of molecular formula C7H16 (interpretation complications with 3-methylhexane and
2,3-dimethylpentane because they exhibit R/S isomerism due to a
chiral carbon) |
Skeletal formula of the
nine
alkane isomers of
molecular formula C7H16 |
Number of 1H NMR chemical shifts (δ) and
proton ratio (links
to spectrum) |
Number of 13C chemical shifts (δ)
(links
to spectrum) |
heptane |
|
|
4 δ: proton ratio: 3:2:2:1 (6:4:4:2 in the molecule) |
4 δ shifts |
2-methylhexane |
|
|
6 δ: proton ratio :
6:3:2:2:2:1 |
6 δ shifts |
3-methylhexane |
|
|
7 δ: proton ratio:
3:3:3:2:2:2:1 (simplification) ! |
7
δ shifts |
3-ethylpentane |
|
|
3 δ: proton ratio:
9:6:1 |
3 δ
shifts |
2,2-dimethylpentane |
|
|
4 δ: proton ratio:
9:3:2:2 |
5 δ shifts |
2,3-dimethylpentane |
|
|
6 δ: proton ratio:
6:3:3:2:1:1 (simplification) ! |
6 δ
shifts (simplification) !!! |
2,4-dimethylpentane |
|
|
3 δ: proton ratio:
12:2:2 |
3 δ
shifts |
3,3-dimethylpentane |
|
|
3 δ: proton ratio:
3:3:2 (6:4:4 in the molecule) |
4 δ
shifts |
2,2,3-trimethylbutane |
|
|
3 δ: proton ratio:
9:6:1 |
4 δ shifts |
Key words & phrases:
C7H16
Interpreting the proton H-1 NMR spectra of 3,3-dimethylpentane, low resolution & high resolution proton
nmr spectra of 3,3-dimethylpentane, H-1 nmr spectrum of 3,3-dimethylpentane, understanding the
hydrogen-1 nmr spectrum of 3,3-dimethylpentane, explaining the line splitting patterns in the
high resolution H-1 nmr spectra of 3,3-dimethylpentane, revising the H-1 nmr spectrum of
3,3-dimethylpentane,
proton nmr of 3,3-dimethylpentane, ppm chemical shifts of the H-1 nmr spectrum of
3,3-dimethylpentane,
explaining and analyzing spin spin line splitting in the H-1 nmr spectrum, how
to construct the diagram of the H-1 nmr spectrum of 3,3-dimethylpentane, how to work out the
number of chemically different protons in the structure of the
3,3-dimethylpentane organic
molecule, how to analyse the chemical shifts in the hydrogen-1 H-1 proton NMR
spectrum of 3,3-dimethylpentane using the n+1 rule to explain the spin - spin coupling ine
splitting in the proton nmr spectrum of 3,3-dimethylpentane deducing the nature of the protons
from the chemical shifts ppm in the H-1 nmr spectrum of 3,3-dimethylpentane
examining the 1H nmr spectrum of 3,3-dimethylpentane analysing the 1-H nmr spectrum of
3,3-dimethylpentane how do you sketch and interpret the H-1 NMR spectrum of
3,3-dimethylpentane
interpreting interpretation of the 1H proton NMR spectrum of 3,3-dimethylpentane
formula
CH3CH2C(CH3)2CH2CH3 Molecular structure diagram of the
proton NMR diagram for the 1H NMR spectrum of 3,3-dimethylpentane. The proton ratio in the
1H NMR spectrum of 3,3-dimethylpentane. Deducing the number of different chemical
environments of the protons in the 3,3-dimethylpentane molecule from the 1H chemical shifts
in the hydrogen-1 NMR spectrum of 3,3-dimethylpentane. Analysing the high resolution 1H NMR
spectrum of 3,3-dimethylpentane. Analysing the low resolution 1H NMR spectrum of
3,3-dimethylpentane. You
may need to know the relative molecular mass of 3,3-dimethylpentane to deduce the molecular
formula from the proton ratio of the 1H NMR spectrum of 3,3-dimethylpentane. Revision notes
on the proton NMR spectrum of 3,3-dimethylpentane. Matching and deducing the structure of
the 3,3-dimethylpentane molecule from its hydrogen-1 NMR spectrum.
Proton NMR spectroscopy of aliphatic alkanes,
1H NMR spectra of 3,3-dimethylpentane, a structural isomer of molecular formula
C7H16
How do you interpret the H-1 NMR spectrum of
3,3-dimethylpentane How to interpret
the H-1 NMR spectrum of 3,3-dimethylpentane Explanatory diagram of the chemical
shifts of the 1H H-1 proton NMR spectrum of the
3,3-dimethylpentane
molecule in terms of its molecular structure. Listing data of all the chemical shift peaks in ppm in the
proton NMR spectrum of 3,3-dimethylpentane. How to explain the H-1 NMR spectrum of
3,3-dimethylpentane. The chemical shifts and integrated values of the proton ratios in the 1-H NMR
spectrum of the 3,3-dimethylpentane molecule. How to work out the molecular
structure of the 3,3-dimethylpentane molecule from its proton NMR spectrum. The uses
and distinctive features of the proton NMR spectrum of the
3,3-dimethylpentane
molecule explained. What does the H-1 proton NMR spectrum chemical
shifts tell us about the
structure and properties of the 3,3-dimethylpentane
molecule? explaining the spin-spin proton coupling effects in the 1H
NMR spectrum of 3,3-dimethylpentane.
interpretation
diagram explaining the proton splitting
pattern produced from the n+1 rule and the theoretical ratio of chemical shift
and values of intensities for the proton NMR spectrum lines of
3,3-dimethylpentane
Links associated
with
3,3-dimethylpentane
The infrared spectrum of
3,3-dimethylpentane
The mass spectrum of
3,3-dimethylpentane
The C-13 NMR spectrum of
3,3-dimethylpentane
The chemistry of ALKANES
revision notes INDEX
H-1 proton NMR spectroscopy index
(Please
read 8 points at the top of the 1H NMR index page)
ALL SPECTROSCOPY INDEXES
All Advanced Organic
Chemistry Notes
Use My Google search site box
Email doc b:
chem55555@hotmail.com
Infrared spectra of the isomers of C7H16
The infrared
spectrum of heptane
The
infrared spectrum of 2-methylhexane
The
infrared spectrum of 3-methylhexane
The
infrared spectrum of 3-ethylpentane
The infrared spectrum of
2,2-dimethylpentane
The infrared spectrum of
2,3-dimethylpentane
The infrared spectrum of
2,4-dimethylpentane
The infrared spectrum of
3,3-dimethylpentane
The infrared spectrum
of 2,2,3-trimethylbutane
|
Mass spectra of the isomers of C7H16
The mass
spectrum of heptane
The mass
spectrum of 2-methylhexane
The mass
spectrum of 3-methylhexane
The
mass spectrum of 3-ethylpentane
The mass spectrum of
2,2-dimethylpentane
The mass spectrum of
2,3-dimethylpentane
The mass spectrum of
2,4-dimethylpentane
The mass spectrum of
3,3-dimethylpentane
The mass
spectrum of 2,2,3-trimethylbutane
|
H-1 proton NMR spectra of ALKANES
1H NMR spectra of the isomers of C7H16
The H-1 NMR
spectrum of heptane
The
H-1 NMR spectrum of 2-methylhexane
The
H-1 NMR spectrum of 3-methylhexane
The
H-1 NMR spectrum of 3-ethylpentane
The H-1 NMR spectrum of
2,2-dimethylpentane
The H-1 NMR spectrum of
2,3-dimethylpentane
The H-1 NMR spectrum of
2,4-dimethylpentane
The H-1 NMR spectrum of
3,3-dimethylpentane
The H-1
NMR spectrum of 2,2,3-trimethylbutane
|
C-13 carbon-13 NMR spectra
of ALKANES
13C NMR spectra of the isomers of C7H16
The C-13 NMR
spectrum of heptane
The
C-13 NMR spectrum of 2-methylhexane
The
C-13 NMR spectrum of 3-methylhexane
The
C-13 NMR spectrum of 3-ethylpentane
The C-13 NMR spectrum of
2,2-dimethylpentane
The C-13 NMR spectrum of
2,3-dimethylpentane
The C-13 NMR spectrum of
2,4-dimethylpentane
The C-13 NMR spectrum of
3,3-dimethylpentane
The
C-13 NMR spectrum of 2,2,3-trimethylbutane
|
|